C24H32FN3O3S — CID 17152786
1-(2-fluorophenyl)-N-[4-(hexylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 17152786) has the molecular formula C24H32FN3O3S and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[4-(hexylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[4-(hexylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17152786 |
| Molecular Formula | C24H32FN3O3S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[4-(hexylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)C2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C24H32FN3O3S/c1-2-3-4-7-16-26-32(30,31)21-12-10-20(11-13-21)27-24(29)19-14-17-28(18-15-19)23-9-6-5-8-22(23)25/h5-6,8-13,19,26H,2-4,7,14-18H2,1H3,(H,27,29) |
| InChIKey | CSGAELGCNNSNPF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|