C17H16Cl2N4O2S2 — CID 25103488
2-[2-[2-[(3,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide (PubChem CID 25103488) has the molecular formula C17H16Cl2N4O2S2 and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-[2-[2-[(3,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[2-[2-[(3,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 25103488 |
| Molecular Formula | C17H16Cl2N4O2S2 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2-[2-[2-[(3,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide |
| SMILES | O=C(CSCC(=O)Nc1ccccc1)NNC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N4O2S2/c18-13-7-6-12(8-14(13)19)21-17(26)23-22-16(25)10-27-9-15(24)20-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,20,24)(H,22,25)(H2,21,23,26) |
| InChIKey | DUGGFUUCMYJLCP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|