C13H11Cl2N5S2 — CID 1253409
1-(3,4-dichlorophenyl)-3-(pyridin-3-ylcarbamothioylamino)thiourea (PubChem CID 1253409) has the molecular formula C13H11Cl2N5S2 and a molecular weight of 372.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(pyridin-3-ylcarbamothioylamino)thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(pyridin-3-ylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 1253409 |
| Molecular Formula | C13H11Cl2N5S2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(pyridin-3-ylcarbamothioylamino)thiourea |
| SMILES | S=C(NNC(=S)Nc1ccc(Cl)c(Cl)c1)Nc1cccnc1 |
| InChI | InChI=1S/C13H11Cl2N5S2/c14-10-4-3-8(6-11(10)15)17-12(21)19-20-13(22)18-9-2-1-5-16-7-9/h1-7H,(H2,17,19,21)(H2,18,20,22) |
| InChIKey | DOIXCLYEOMYTAE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|