C14H12Cl2N2S2 — CID 2439903
1-(3,4-dichlorophenyl)-3-(3-methylsulfanylphenyl)thiourea (PubChem CID 2439903) has the molecular formula C14H12Cl2N2S2 and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(3-methylsulfanylphenyl)thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(3-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 2439903 |
| Molecular Formula | C14H12Cl2N2S2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(3-methylsulfanylphenyl)thiourea |
| SMILES | CSc1cccc(NC(=S)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H12Cl2N2S2/c1-20-11-4-2-3-9(7-11)17-14(19)18-10-5-6-12(15)13(16)8-10/h2-8H,1H3,(H2,17,18,19) |
| InChIKey | XPEZRDOPKOPNOU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|