C14H12F2N2S2 — CID 53488867
1-(3,5-difluorophenyl)-3-(3-methylsulfanylphenyl)thiourea (PubChem CID 53488867) has the molecular formula C14H12F2N2S2 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(3-methylsulfanylphenyl)thiourea.
| Compound Name | 1-(3,5-difluorophenyl)-3-(3-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 53488867 |
| Molecular Formula | C14H12F2N2S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(3-methylsulfanylphenyl)thiourea |
| SMILES | CSc1cccc(NC(=S)Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C14H12F2N2S2/c1-20-13-4-2-3-11(8-13)17-14(19)18-12-6-9(15)5-10(16)7-12/h2-8H,1H3,(H2,17,18,19) |
| InChIKey | YISLZGQPZGWVGV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|