C20H16F2N4S2 — CID 3450278
1-(4-fluorophenyl)-3-[3-[(4-fluorophenyl)carbamothioylamino]phenyl]thiourea (PubChem CID 3450278) has the molecular formula C20H16F2N4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-[(4-fluorophenyl)carbamothioylamino]phenyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[3-[(4-fluorophenyl)carbamothioylamino]phenyl]thiourea |
|---|---|
| PubChem CID | 3450278 |
| Molecular Formula | C20H16F2N4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-[(4-fluorophenyl)carbamothioylamino]phenyl]thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2cccc(NC(=S)Nc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C20H16F2N4S2/c21-13-4-8-15(9-5-13)23-19(27)25-17-2-1-3-18(12-17)26-20(28)24-16-10-6-14(22)7-11-16/h1-12H,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | CYRUPEWRQANIHY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|