C19H15F2N5S2 — CID 2731256
1-(4-fluorophenyl)-3-[6-[(4-fluorophenyl)carbamothioylamino]-2-pyridinyl]thiourea (PubChem CID 2731256) has the molecular formula C19H15F2N5S2 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[6-[(4-fluorophenyl)carbamothioylamino]-2-pyridinyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[6-[(4-fluorophenyl)carbamothioylamino]-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 2731256 |
| Molecular Formula | C19H15F2N5S2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[6-[(4-fluorophenyl)carbamothioylamino]-2-pyridinyl]thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2cccc(NC(=S)Nc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H15F2N5S2/c20-12-4-8-14(9-5-12)22-18(27)25-16-2-1-3-17(24-16)26-19(28)23-15-10-6-13(21)7-11-15/h1-11H,(H4,22,23,24,25,26,27,28) |
| InChIKey | OXBXGJUAOLHTDW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|