C9H8FN5S — CID 8655631
1-(4-fluorophenyl)-3-(1,2,4-triazol-4-yl)thiourea (PubChem CID 8655631) has the molecular formula C9H8FN5S and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(1,2,4-triazol-4-yl)thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-(1,2,4-triazol-4-yl)thiourea |
|---|---|
| PubChem CID | 8655631 |
| Molecular Formula | C9H8FN5S |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(1,2,4-triazol-4-yl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C9H8FN5S/c10-7-1-3-8(4-2-7)13-9(16)14-15-5-11-12-6-15/h1-6H,(H2,13,14,16) |
| InChIKey | MTKJWSJGNSJIBT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|