C14H10F4N2S — CID 5053889
1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 5053889) has the molecular formula C14H10F4N2S and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 5053889 |
| Molecular Formula | C14H10F4N2S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H10F4N2S/c15-10-3-7-12(8-4-10)20-13(21)19-11-5-1-9(2-6-11)14(16,17)18/h1-8H,(H2,19,20,21) |
| InChIKey | QLYKEBLTBAGGFM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|