C8H9FN4S2 — CID 681193
1-(carbamothioylamino)-3-(4-fluorophenyl)thiourea (PubChem CID 681193) has the molecular formula C8H9FN4S2 and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-(carbamothioylamino)-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-(carbamothioylamino)-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 681193 |
| Molecular Formula | C8H9FN4S2 |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1-(carbamothioylamino)-3-(4-fluorophenyl)thiourea |
| SMILES | NC(=S)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C8H9FN4S2/c9-5-1-3-6(4-2-5)11-8(15)13-12-7(10)14/h1-4H,(H3,10,12,14)(H2,11,13,15) |
| InChIKey | IUBRKXPNPOHVIY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|