C14H18FN5O2S — CID 9085378
(3R)-3-[[(4-fluorophenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide (PubChem CID 9085378) has the molecular formula C14H18FN5O2S and a molecular weight of 339.40 g/mol. Its IUPAC name is (3R)-3-[[(4-fluorophenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[[(4-fluorophenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9085378 |
| Molecular Formula | C14H18FN5O2S |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3R)-3-[[(4-fluorophenyl)carbamothioylamino]carbamoyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)NNC(=S)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H18FN5O2S/c15-10-3-5-11(6-4-10)17-14(23)19-18-12(21)9-2-1-7-20(8-9)13(16)22/h3-6,9H,1-2,7-8H2,(H2,16,22)(H,18,21)(H2,17,19,23)/t9-/m1/s1 |
| InChIKey | QKFSQVSVXYABML-SECBINFHSA-N |
| XLogP | 0.93 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|