C18H25FN4O2 — CID 95286790
(3R)-3-N-(5-fluoro-2-piperidin-1-ylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 95286790) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is (3R)-3-N-(5-fluoro-2-piperidin-1-ylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-(5-fluoro-2-piperidin-1-ylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95286790 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (3R)-3-N-(5-fluoro-2-piperidin-1-ylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)Nc2cc(F)ccc2N2CCCCC2)C1 |
| InChI | InChI=1S/C18H25FN4O2/c19-14-6-7-16(22-8-2-1-3-9-22)15(11-14)21-17(24)13-5-4-10-23(12-13)18(20)25/h6-7,11,13H,1-5,8-10,12H2,(H2,20,25)(H,21,24)/t13-/m1/s1 |
| InChIKey | ABBNCSMESYFADY-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |