C11H15N5O4 — CID 64526678
3-[(1-carbamoylpiperidine-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64526678) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-[(1-carbamoylpiperidine-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(1-carbamoylpiperidine-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64526678 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-[(1-carbamoylpiperidine-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | NC(=O)N1CCCC(C(=O)Nc2cc(C(=O)O)[nH]n2)C1 |
| InChI | InChI=1S/C11H15N5O4/c12-11(20)16-3-1-2-6(5-16)9(17)13-8-4-7(10(18)19)14-15-8/h4,6H,1-3,5H2,(H2,12,20)(H,18,19)(H2,13,14,15,17) |
| InChIKey | UUEOFLFKUMNSRP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |