C12H19N5O2 — CID 112689240
3-N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-1,3-dicarboxamide (PubChem CID 112689240) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 112689240 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1[nH]nc(NC(=O)C2CCCN(C(N)=O)C2)c1C |
| InChI | InChI=1S/C12H19N5O2/c1-7-8(2)15-16-10(7)14-11(18)9-4-3-5-17(6-9)12(13)19/h9H,3-6H2,1-2H3,(H2,13,19)(H2,14,15,16,18) |
| InChIKey | BWKKWZONRWXXQB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |