C11H18N6O3 — CID 104817596
3-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)piperidine-1,3-dicarboxamide (PubChem CID 104817596) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 104817596 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)piperidine-1,3-dicarboxamide |
| SMILES | CCOc1n[nH]c(NC(=O)C2CCCN(C(N)=O)C2)n1 |
| InChI | InChI=1S/C11H18N6O3/c1-2-20-11-14-10(15-16-11)13-8(18)7-4-3-5-17(6-7)9(12)19/h7H,2-6H2,1H3,(H2,12,19)(H2,13,14,15,16,18) |
| InChIKey | LPIUTLNQJMFHAD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |