C9H15N3O5 — CID 63914917
2-[(1-carbamoylpiperidine-3-carbonyl)amino]oxyacetic acid (PubChem CID 63914917) has the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-[(1-carbamoylpiperidine-3-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(1-carbamoylpiperidine-3-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 63914917 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[(1-carbamoylpiperidine-3-carbonyl)amino]oxyacetic acid |
| SMILES | NC(=O)N1CCCC(C(=O)NOCC(=O)O)C1 |
| InChI | InChI=1S/C9H15N3O5/c10-9(16)12-3-1-2-6(4-12)8(15)11-17-5-7(13)14/h6H,1-5H2,(H2,10,16)(H,11,15)(H,13,14) |
| InChIKey | ZOIDVHGLEVOTNA-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|