C12H21N3O3 — CID 83202179
3-N-cyclopentyloxypiperidine-1,3-dicarboxamide (PubChem CID 83202179) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-N-cyclopentyloxypiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-cyclopentyloxypiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 83202179 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-N-cyclopentyloxypiperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCCC(C(=O)NOC2CCCC2)C1 |
| InChI | InChI=1S/C12H21N3O3/c13-12(17)15-7-3-4-9(8-15)11(16)14-18-10-5-1-2-6-10/h9-10H,1-8H2,(H2,13,17)(H,14,16) |
| InChIKey | FAHOWJMPCCFMKU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|