C13H23N3O2 — CID 114550176
3-N-(3-methylcyclopentyl)piperidine-1,3-dicarboxamide (PubChem CID 114550176) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-N-(3-methylcyclopentyl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(3-methylcyclopentyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 114550176 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-N-(3-methylcyclopentyl)piperidine-1,3-dicarboxamide |
| SMILES | CC1CCC(NC(=O)C2CCCN(C(N)=O)C2)C1 |
| InChI | InChI=1S/C13H23N3O2/c1-9-4-5-11(7-9)15-12(17)10-3-2-6-16(8-10)13(14)18/h9-11H,2-8H2,1H3,(H2,14,18)(H,15,17) |
| InChIKey | NEAYQUIKXFUXOJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |