C12H21N3O2 — CID 60756437
3-N-cyclopropyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 60756437) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-N-cyclopropyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-cyclopropyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 60756437 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-N-cyclopropyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C12H21N3O2/c1-14(2)12(17)15-7-3-4-9(8-15)11(16)13-10-5-6-10/h9-10H,3-8H2,1-2H3,(H,13,16) |
| InChIKey | WMYQOENWGOCZDA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |