C9H18N4O2 — CID 43348977
3-(hydrazinecarbonyl)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 43348977) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(hydrazinecarbonyl)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 3-(hydrazinecarbonyl)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 43348977 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 3-(hydrazinecarbonyl)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)NN)C1 |
| InChI | InChI=1S/C9H18N4O2/c1-12(2)9(15)13-5-3-4-7(6-13)8(14)11-10/h7H,3-6,10H2,1-2H3,(H,11,14) |
| InChIKey | NQYHBCPFKIUGCG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|