C11H21N3O3 — CID 60767416
3-N-methoxy-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide (PubChem CID 60767416) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-N-methoxy-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-methoxy-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 60767416 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3-N-methoxy-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide |
| SMILES | CON(C)C(=O)C1CCCN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C11H21N3O3/c1-12(2)11(16)14-7-5-6-9(8-14)10(15)13(3)17-4/h9H,5-8H2,1-4H3 |
| InChIKey | REWZGFNNGIBJHH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|