C15H29N3O3 — CID 107202052
3-N-(5-hydroxypentyl)-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide (PubChem CID 107202052) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-N-(5-hydroxypentyl)-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(5-hydroxypentyl)-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 107202052 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3-N-(5-hydroxypentyl)-1-N,1-N,3-N-trimethylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)N(C)CCCCCO)C1 |
| InChI | InChI=1S/C15H29N3O3/c1-16(2)15(21)18-10-7-8-13(12-18)14(20)17(3)9-5-4-6-11-19/h13,19H,4-12H2,1-3H3 |
| InChIKey | FYYNUQVDFTWYFD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|