C12H24N2O2 — CID 110931950
1-(4-hydroxybutyl)-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 110931950) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | 1-(4-hydroxybutyl)-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110931950 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-(4-hydroxybutyl)-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN(CCCCO)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-13(2)12(16)11-6-5-8-14(10-11)7-3-4-9-15/h11,15H,3-10H2,1-2H3 |
| InChIKey | QDVUQWNXZVXIQU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|