About 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide
1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide (PubChem CID 90679730) has the molecular formula C19H38N2O
and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide |
| PubChem CID | 90679730 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide |
| SMILES | CCCCCCCCCCN1CCCC(C(=O)N(C)CC)C1 |
| InChI | InChI=1S/C19H38N2O/c1-4-6-7-8-9-10-11-12-15-21-16-13-14-18(17-21)19(22)20(3)5-2/h18H,4-17H2,1-3H3 |
| InChIKey | YXLLRNGIFYOCKA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide?
The IUPAC name of 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide (CID 90679730) is 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide.
What is the SMILES notation for 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide?
The canonical SMILES for 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide is CCCCCCCCCCN1CCCC(C(=O)N(C)CC)C1.
What is the InChIKey of 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide?
The InChIKey is YXLLRNGIFYOCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2O/c1-4-6-7-8-9-10-11-12-15-21-16-13-14-18(17-21)19(22)20(3)5-2/h18H,4-17H2,1-3H3.
What are the key properties of 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide?
1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide has a molecular weight of 310.53 g/mol, XLogP of 4.32, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-N-ethyl-N-methylpiperidine-3-carboxamide is sourced from PubChem (CID 90679730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).