C12H23N3O3 — CID 94123913
(3R)-3-N-methoxy-3-N-methyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide (PubChem CID 94123913) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R)-3-N-methoxy-3-N-methyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-methoxy-3-N-methyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94123913 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (3R)-3-N-methoxy-3-N-methyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
| SMILES | CON(C)C(=O)[C@@H]1CCCN(C(=O)NC(C)C)C1 |
| InChI | InChI=1S/C12H23N3O3/c1-9(2)13-12(17)15-7-5-6-10(8-15)11(16)14(3)18-4/h9-10H,5-8H2,1-4H3,(H,13,17)/t10-/m1/s1 |
| InChIKey | ORNWZPBWHNYSPJ-SNVBAGLBSA-N |
| XLogP | 0.84 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|