C11H15F3N2O2 — CID 110344179
N-cyclopropyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide (PubChem CID 110344179) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is N-cyclopropyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110344179 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-cyclopropyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CC1)C1CCCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F3N2O2/c12-11(13,14)10(18)16-5-1-2-7(6-16)9(17)15-8-3-4-8/h7-8H,1-6H2,(H,15,17) |
| InChIKey | FKJVCWCKXZFOJL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |