C14H14BrF3N2O2 — CID 110344301
N-(4-bromophenyl)-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide (PubChem CID 110344301) has the molecular formula C14H14BrF3N2O2 and a molecular weight of 379.18 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110344301 |
| Molecular Formula | C14H14BrF3N2O2 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-(4-bromophenyl)-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1CCCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14BrF3N2O2/c15-10-3-5-11(6-4-10)19-12(21)9-2-1-7-20(8-9)13(22)14(16,17)18/h3-6,9H,1-2,7-8H2,(H,19,21) |
| InChIKey | NMQCLJOSUKVPEO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |