C12H19F3N2O2 — CID 110344181
N-butyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide (PubChem CID 110344181) has the molecular formula C12H19F3N2O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-butyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide.
| Compound Name | N-butyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110344181 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-butyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N2O2/c1-2-3-6-16-10(18)9-5-4-7-17(8-9)11(19)12(13,14)15/h9H,2-8H2,1H3,(H,16,18) |
| InChIKey | RICJNBBPYNTZRF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|