C14H25N3O2 — CID 32567673
(3R)-3-N-[(1R,3R)-3-methylcyclohexyl]piperidine-1,3-dicarboxamide (PubChem CID 32567673) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is (3R)-3-N-[(1R,3R)-3-methylcyclohexyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[(1R,3R)-3-methylcyclohexyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 32567673 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | (3R)-3-N-[(1R,3R)-3-methylcyclohexyl]piperidine-1,3-dicarboxamide |
| SMILES | C[C@@H]1CCC[C@@H](NC(=O)[C@@H]2CCCN(C(N)=O)C2)C1 |
| InChI | InChI=1S/C14H25N3O2/c1-10-4-2-6-12(8-10)16-13(18)11-5-3-7-17(9-11)14(15)19/h10-12H,2-9H2,1H3,(H2,15,19)(H,16,18)/t10-,11-,12-/m1/s1 |
| InChIKey | LDMMQYLIWXAMLS-IJLUTSLNSA-N |
| XLogP | 1.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |