C13H22N2O — CID 141395665
N-[(1R,3S)-3-methylcyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 141395665) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[(1R,3S)-3-methylcyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-[(1R,3S)-3-methylcyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 141395665 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[(1R,3S)-3-methylcyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | C[C@H]1CCC[C@@H](NC(=O)C2CC3CN3C2)C1 |
| InChI | InChI=1S/C13H22N2O/c1-9-3-2-4-11(5-9)14-13(16)10-6-12-8-15(12)7-10/h9-12H,2-8H2,1H3,(H,14,16)/t9-,10?,11+,12?,15?/m0/s1 |
| InChIKey | IEUFAUWQKPMOBQ-DNHIIJNJSA-N |
| XLogP | 1.39 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|