C12H20N2O2 — CID 141395652
N-[(1S,3S)-3-methoxycyclopentyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 141395652) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-[(1S,3S)-3-methoxycyclopentyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-[(1S,3S)-3-methoxycyclopentyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 141395652 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-[(1S,3S)-3-methoxycyclopentyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CO[C@H]1CC[C@H](NC(=O)C2CC3CN3C2)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-16-11-3-2-9(5-11)13-12(15)8-4-10-7-14(10)6-8/h8-11H,2-7H2,1H3,(H,13,15)/t8?,9-,10?,11-,14?/m0/s1 |
| InChIKey | QCHQJXMEUCWLAA-LJBRSCCQSA-N |
| XLogP | 0.37 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|