C17H31N3O2 — CID 49477403
1-N-(3-methylcyclohexyl)-3-N-propylpiperidine-1,3-dicarboxamide (PubChem CID 49477403) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-N-(3-methylcyclohexyl)-3-N-propylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-methylcyclohexyl)-3-N-propylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 49477403 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 1-N-(3-methylcyclohexyl)-3-N-propylpiperidine-1,3-dicarboxamide |
| SMILES | CCCNC(=O)C1CCCN(C(=O)NC2CCCC(C)C2)C1 |
| InChI | InChI=1S/C17H31N3O2/c1-3-9-18-16(21)14-7-5-10-20(12-14)17(22)19-15-8-4-6-13(2)11-15/h13-15H,3-12H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | QUNLLUUERPKXJD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |