C21H31N3O2 — CID 7435336
(3S)-1-N-cyclohexyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide (PubChem CID 7435336) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (3S)-1-N-cyclohexyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-cyclohexyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 7435336 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (3S)-1-N-cyclohexyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)[C@H]1CCCN(C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C21H31N3O2/c25-20(22-14-13-17-8-3-1-4-9-17)18-10-7-15-24(16-18)21(26)23-19-11-5-2-6-12-19/h1,3-4,8-9,18-19H,2,5-7,10-16H2,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | AOFDBOPUGUYPQX-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |