C9H14F3N3O3 — CID 81340627
3-N-(2,2,2-trifluoroethoxy)piperidine-1,3-dicarboxamide (PubChem CID 81340627) has the molecular formula C9H14F3N3O3 and a molecular weight of 269.22 g/mol. Its IUPAC name is 3-N-(2,2,2-trifluoroethoxy)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2,2,2-trifluoroethoxy)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 81340627 |
| Molecular Formula | C9H14F3N3O3 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-N-(2,2,2-trifluoroethoxy)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCCC(C(=O)NOCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3N3O3/c10-9(11,12)5-18-14-7(16)6-2-1-3-15(4-6)8(13)17/h6H,1-5H2,(H2,13,17)(H,14,16) |
| InChIKey | PDVPGKMIUWHZFC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|