C8H14F3N3O — CID 83992254
3-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide (PubChem CID 83992254) has the molecular formula C8H14F3N3O and a molecular weight of 225.21 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide.
| Compound Name | 3-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 83992254 |
| Molecular Formula | C8H14F3N3O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCC(NCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3N3O/c9-8(10,11)5-13-6-2-1-3-14(4-6)7(12)15/h6,13H,1-5H2,(H2,12,15) |
| InChIKey | RNUMKSJSUHQJAD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |