C8H15N3O3 — CID 177272345
[(3R)-1-(2-hydroxyacetyl)piperidin-3-yl]urea (PubChem CID 177272345) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is [(3R)-1-(2-hydroxyacetyl)piperidin-3-yl]urea.
| Compound Name | [(3R)-1-(2-hydroxyacetyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 177272345 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | [(3R)-1-(2-hydroxyacetyl)piperidin-3-yl]urea |
| SMILES | NC(=O)N[C@@H]1CCCN(C(=O)CO)C1 |
| InChI | InChI=1S/C8H15N3O3/c9-8(14)10-6-2-1-3-11(4-6)7(13)5-12/h6,12H,1-5H2,(H3,9,10,14)/t6-/m1/s1 |
| InChIKey | XEJTZTLEHNEALN-ZCFIWIBFSA-N |
| XLogP | -1.36 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |