C10H14N4O3 — CID 177272408
[(3R)-1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]urea (PubChem CID 177272408) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is [(3R)-1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]urea.
| Compound Name | [(3R)-1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 177272408 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [(3R)-1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]urea |
| SMILES | NC(=O)N[C@@H]1CCCN(C(=O)c2ccon2)C1 |
| InChI | InChI=1S/C10H14N4O3/c11-10(16)12-7-2-1-4-14(6-7)9(15)8-3-5-17-13-8/h3,5,7H,1-2,4,6H2,(H3,11,12,16)/t7-/m1/s1 |
| InChIKey | VRGNCXPEFXHGDO-SSDOTTSWSA-N |
| XLogP | -0.05 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |