C12H17N3O4 — CID 75417290
ethyl N-[1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]carbamate (PubChem CID 75417290) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl N-[1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 75417290 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | ethyl N-[1-(1,2-oxazole-3-carbonyl)piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)c2ccon2)C1 |
| InChI | InChI=1S/C12H17N3O4/c1-2-18-12(17)13-9-4-3-6-15(8-9)11(16)10-5-7-19-14-10/h5,7,9H,2-4,6,8H2,1H3,(H,13,17) |
| InChIKey | HWDLOOWRFTUFIX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |