About ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate
ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate (PubChem CID 94140906) has the molecular formula C15H17ClF2N2O3
and a molecular weight of 346.76 g/mol. Its IUPAC name is ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate |
| PubChem CID | 94140906 |
| Molecular Formula | C15H17ClF2N2O3 |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CCCN(C(=O)c2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C15H17ClF2N2O3/c1-2-23-15(22)19-9-4-3-5-20(8-9)14(21)10-6-12(17)13(18)7-11(10)16/h6-7,9H,2-5,8H2,1H3,(H,19,22)/t9-/m1/s1 |
| InChIKey | QDINLBHBPULCJN-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate?
The IUPAC name of ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate (CID 94140906) is ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate.
What is the SMILES notation for ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate?
The canonical SMILES for ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate is CCOC(=O)N[C@@H]1CCCN(C(=O)c2cc(F)c(F)cc2Cl)C1.
What is the InChIKey of ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate?
The InChIKey is QDINLBHBPULCJN-SECBINFHSA-N. The full InChI is InChI=1S/C15H17ClF2N2O3/c1-2-23-15(22)19-9-4-3-5-20(8-9)14(21)10-6-12(17)13(18)7-11(10)16/h6-7,9H,2-5,8H2,1H3,(H,19,22)/t9-/m1/s1.
What are the key properties of ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate?
ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate has a molecular weight of 346.76 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3R)-1-(2-chloro-4,5-difluorobenzoyl)piperidin-3-yl]carbamate is sourced from PubChem (CID 94140906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).