C13H22N2O4 — CID 94183634
ethyl N-[(3R)-1-[(2R)-oxolane-2-carbonyl]piperidin-3-yl]carbamate (PubChem CID 94183634) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is ethyl N-[(3R)-1-[(2R)-oxolane-2-carbonyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[(3R)-1-[(2R)-oxolane-2-carbonyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 94183634 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | ethyl N-[(3R)-1-[(2R)-oxolane-2-carbonyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CCCN(C(=O)[C@H]2CCCO2)C1 |
| InChI | InChI=1S/C13H22N2O4/c1-2-18-13(17)14-10-5-3-7-15(9-10)12(16)11-6-4-8-19-11/h10-11H,2-9H2,1H3,(H,14,17)/t10-,11-/m1/s1 |
| InChIKey | BVDRLZHXGNSELG-GHMZBOCLSA-N |
| XLogP | 0.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |