C13H23N3O4 — CID 60962909
ethyl N-[1-(4-hydroxypyrrolidine-2-carbonyl)piperidin-3-yl]carbamate (PubChem CID 60962909) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl N-[1-(4-hydroxypyrrolidine-2-carbonyl)piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-(4-hydroxypyrrolidine-2-carbonyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 60962909 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl N-[1-(4-hydroxypyrrolidine-2-carbonyl)piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)C2CC(O)CN2)C1 |
| InChI | InChI=1S/C13H23N3O4/c1-2-20-13(19)15-9-4-3-5-16(8-9)12(18)11-6-10(17)7-14-11/h9-11,14,17H,2-8H2,1H3,(H,15,19) |
| InChIKey | VZFHAOKEJVYWKH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |