C14H25N3O3 — CID 119763378
1-(4-hydroxypyrrolidine-2-carbonyl)-N-propylpiperidine-3-carboxamide (PubChem CID 119763378) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(4-hydroxypyrrolidine-2-carbonyl)-N-propylpiperidine-3-carboxamide.
| Compound Name | 1-(4-hydroxypyrrolidine-2-carbonyl)-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119763378 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(4-hydroxypyrrolidine-2-carbonyl)-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CCCN(C(=O)C2CC(O)CN2)C1 |
| InChI | InChI=1S/C14H25N3O3/c1-2-5-15-13(19)10-4-3-6-17(9-10)14(20)12-7-11(18)8-16-12/h10-12,16,18H,2-9H2,1H3,(H,15,19) |
| InChIKey | JVAVKFGGQCZPGK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |