C14H16N2O2 — CID 167484647
benzene;1,2-oxazol-3-yl(pyrrolidin-1-yl)methanone (PubChem CID 167484647) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is benzene;1,2-oxazol-3-yl(pyrrolidin-1-yl)methanone.
| Compound Name | benzene;1,2-oxazol-3-yl(pyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 167484647 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | benzene;1,2-oxazol-3-yl(pyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccon1)N1CCCC1.c1ccccc1 |
| InChI | InChI=1S/C8H10N2O2.C6H6/c11-8(7-3-6-12-9-7)10-4-1-2-5-10;1-2-4-6-5-3-1/h3,6H,1-2,4-5H2;1-6H |
| InChIKey | BDKVKKJQWJLXRR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |