(2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid

C10H12N2O4 — CID 66263273

IUPAC(2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCCCN1C(=O)c1ccon1
InChIInChI=1S/C10H12N2O4/c13-9(7-4-6-16-11-7)12-5-2-1-3-8(12)10(14)15/h4,6,8H,1-3,5H2,(H,14,15)/t8-/m0/s1
InChIKeyPOIGKQDUQLDTBE-QMMMGPOBSA-N
MW224.22 g/mol
LogP0.75
Rot. Bonds2

About (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid

(2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid (PubChem CID 66263273) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid
PubChem CID66263273
Molecular FormulaC10H12N2O4
Molecular Weight224.22 g/mol
Exact Mass224.08
IUPAC Name(2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCCCN1C(=O)c1ccon1
InChIInChI=1S/C10H12N2O4/c13-9(7-4-6-16-11-7)12-5-2-1-3-8(12)10(14)15/h4,6,8H,1-3,5H2,(H,14,15)/t8-/m0/s1
InChIKeyPOIGKQDUQLDTBE-QMMMGPOBSA-N
XLogP0.75
TPSA83.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.22
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid?
The IUPAC name of (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid (CID 66263273) is (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid.
What is the SMILES notation for (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid?
The canonical SMILES for (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid is O=C(O)[C@@H]1CCCCN1C(=O)c1ccon1.
What is the InChIKey of (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid?
The InChIKey is POIGKQDUQLDTBE-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H12N2O4/c13-9(7-4-6-16-11-7)12-5-2-1-3-8(12)10(14)15/h4,6,8H,1-3,5H2,(H,14,15)/t8-/m0/s1.
What are the key properties of (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid?
(2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid has a molecular weight of 224.22 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(1,2-oxazole-3-carbonyl)piperidine-2-carboxylic acid is sourced from PubChem (CID 66263273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).