C15H15ClN2O3 — CID 75388459
[4-(2-chlorophenoxy)piperidin-1-yl]-(1,2-oxazol-3-yl)methanone (PubChem CID 75388459) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is [4-(2-chlorophenoxy)piperidin-1-yl]-(1,2-oxazol-3-yl)methanone.
| Compound Name | [4-(2-chlorophenoxy)piperidin-1-yl]-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 75388459 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [4-(2-chlorophenoxy)piperidin-1-yl]-(1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccon1)N1CCC(Oc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H15ClN2O3/c16-12-3-1-2-4-14(12)21-11-5-8-18(9-6-11)15(19)13-7-10-20-17-13/h1-4,7,10-11H,5-6,8-9H2 |
| InChIKey | IEIVYNLHGIXTSS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |