C14H14FN3O2 — CID 110693755
[4-(2-fluorophenyl)piperazin-1-yl]-(1,2-oxazol-3-yl)methanone (PubChem CID 110693755) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-(1,2-oxazol-3-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 110693755 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-(1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccon1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H14FN3O2/c15-11-3-1-2-4-13(11)17-6-8-18(9-7-17)14(19)12-5-10-20-16-12/h1-5,10H,6-9H2 |
| InChIKey | HXJRZDAMJVXITO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |