C20H25FN6O — CID 109302241
[2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 109302241) has the molecular formula C20H25FN6O and a molecular weight of 384.46 g/mol. Its IUPAC name is [2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109302241 |
| Molecular Formula | C20H25FN6O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccnc(N3CCN(c4ccccc4F)CC3)n2)CC1 |
| InChI | InChI=1S/C20H25FN6O/c1-24-8-10-26(11-9-24)19(28)17-6-7-22-20(23-17)27-14-12-25(13-15-27)18-5-3-2-4-16(18)21/h2-7H,8-15H2,1H3 |
| InChIKey | FTEZTSNHARMJDM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |