C18H22FN5O — CID 109295385
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 109295385) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109295385 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)NC(=O)c1ccnc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C18H22FN5O/c1-13(2)21-17(25)15-7-8-20-18(22-15)24-11-9-23(10-12-24)16-6-4-3-5-14(16)19/h3-8,13H,9-12H2,1-2H3,(H,21,25) |
| InChIKey | XLTWIEHYPDDKQU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |