C17H22FN5O — CID 112885713
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine (PubChem CID 112885713) has the molecular formula C17H22FN5O and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112885713 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine |
| SMILES | COCCNc1ccnc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C17H22FN5O/c1-24-13-8-19-16-6-7-20-17(21-16)23-11-9-22(10-12-23)15-5-3-2-4-14(15)18/h2-7H,8-13H2,1H3,(H,19,20,21) |
| InChIKey | IBFLHIOUHPTPLV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|