3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid

C12H16N2O4 — CID 62215797

IUPAC3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid
SMILESO=C(O)CCC1CCN(C(=O)c2ccon2)CC1
InChIInChI=1S/C12H16N2O4/c15-11(16)2-1-9-3-6-14(7-4-9)12(17)10-5-8-18-13-10/h5,8-9H,1-4,6-7H2,(H,15,16)
InChIKeyMNBMQKXGDPQRCX-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.39
Rot. Bonds4

About 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid

3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid (PubChem CID 62215797) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid
PubChem CID62215797
Molecular FormulaC12H16N2O4
Molecular Weight252.27 g/mol
Exact Mass252.11
IUPAC Name3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid
SMILESO=C(O)CCC1CCN(C(=O)c2ccon2)CC1
InChIInChI=1S/C12H16N2O4/c15-11(16)2-1-9-3-6-14(7-4-9)12(17)10-5-8-18-13-10/h5,8-9H,1-4,6-7H2,(H,15,16)
InChIKeyMNBMQKXGDPQRCX-UHFFFAOYSA-N
XLogP1.39
TPSA83.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid?
The IUPAC name of 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid (CID 62215797) is 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid.
What is the SMILES notation for 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid?
The canonical SMILES for 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid is O=C(O)CCC1CCN(C(=O)c2ccon2)CC1.
What is the InChIKey of 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid?
The InChIKey is MNBMQKXGDPQRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c15-11(16)2-1-9-3-6-14(7-4-9)12(17)10-5-8-18-13-10/h5,8-9H,1-4,6-7H2,(H,15,16).
What are the key properties of 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid?
3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid has a molecular weight of 252.27 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(1,2-oxazole-3-carbonyl)piperidin-4-yl]propanoic acid is sourced from PubChem (CID 62215797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).